Products 527751-48-0
CAS 527751-48-0 appears in our catalog under these names: 2-(4-Chlorophenyl)-5'-fluoro-2'-hydroxyacetophenone, 95%, 2-(4-Chlorophenyl)-5'-fluoro-2'-hydroxyacetophenone, ≥95%, ≥95%, 2-(4-CHLOROPHENYL)-1-(5-FLUORO-2-HYDROXYPHENYL)ETHAN-1-ONE, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(4-chlorophenyl)-1-(5-fluoro-2-hydroxyphenyl)ethanone (CAS 527751-48-0) is a chemical compound with the molecular formula C14H10ClFO2 and a molecular weight of 264.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-(5-fluoro-2-hydroxyphenyl)ethanone. InChIKey: DEQFRUBBOCSQOC-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO2 |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-(5-fluoro-2-hydroxyphenyl)ethanone |
| InChIKey | DEQFRUBBOCSQOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C2=C(C=CC(=C2)F)O)Cl |
Computed by PubChem (NCBI)