Products 5278-84-2

CAS 5278-84-2 is the registry number for 3-Phenylbenzo[f]quinoline-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-phenylbenzo[f]quinoline-1-carboxylic acid (CAS 5278-84-2) is a chemical compound with the molecular formula C20H13NO2 and a molecular weight of 299.3 g/mol. IUPAC name: 3-phenylbenzo[f]quinoline-1-carboxylic acid. InChIKey: LVGBEBWTJLZXJN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H13NO2
Molecular weight299.3 g/mol
IUPAC name3-phenylbenzo[f]quinoline-1-carboxylic acid
InChIKeyLVGBEBWTJLZXJN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(C4=CC=CC=C4C=C3)C(=C2)C(=O)O

Computed by PubChem (NCBI)