CAS 528-93-8 is the registry number for 2-hydroxybenzoic acid, silver(I) Salt, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Silver 2-carboxyphenolate (CAS 528-93-8) is a chemical compound with the molecular formula C7H5AgO3 and a molecular weight of 244.98 g/mol. IUPAC name: silver 2-carboxyphenolate. InChIKey: QOVGHSPSIUCXQC-UHFFFAOYSA-M.
| Molecular formula | C7H5AgO3 |
|---|---|
| Molecular weight | 244.98 g/mol |
| IUPAC name | silver 2-carboxyphenolate |
| InChIKey | QOVGHSPSIUCXQC-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[O-].[Ag+] |
Computed by PubChem (NCBI)