CAS 5280-66-0 appears in our catalog under these names: (4-(2-(5-Chloro-4-methyl-2-(sulfo-ko)phenyl)diazenyl-kn1)-3-(hydroxy-ko)-2-naphthalenecarboxylato(3-))-manganate(1-) hydrogen (1:1), 95%, C.I. Pigment Red 48:4, Pigment Red 48:4. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 1g, 25g, 5g, 50g, Get quote.
4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid (CAS 5280-66-0) is a chemical compound with the molecular formula C18H13ClN2O6S and a molecular weight of 420.8 g/mol. IUPAC name: 4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: LZNMMJSXOXXHFD-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN2O6S |
|---|---|
| Molecular weight | 420.8 g/mol |
| IUPAC name | 4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | LZNMMJSXOXXHFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)