Products 5284-79-7

CAS 5284-79-7 is the registry number for 2,6-Bis(4-Azidobenzylidene)-4-Methylcyclohexanone, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one (CAS 5284-79-7) is a chemical compound with the molecular formula C21H18N6O and a molecular weight of 370.4 g/mol. IUPAC name: 2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one. InChIKey: MLIWQXBKMZNZNF-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18N6O
Molecular weight370.4 g/mol
IUPAC name2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one
InChIKeyMLIWQXBKMZNZNF-UHFFFAOYSA-N
SMILESCC1CC(=CC2=CC=C(C=C2)N=[N+]=[N-])C(=O)C(=CC3=CC=C(C=C3)N=[N+]=[N-])C1

Computed by PubChem (NCBI)