CAS 5284-79-7 is the registry number for 2,6-Bis(4-Azidobenzylidene)-4-Methylcyclohexanone, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one (CAS 5284-79-7) is a chemical compound with the molecular formula C21H18N6O and a molecular weight of 370.4 g/mol. IUPAC name: 2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one. InChIKey: MLIWQXBKMZNZNF-UHFFFAOYSA-N.
| Molecular formula | C21H18N6O |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one |
| InChIKey | MLIWQXBKMZNZNF-UHFFFAOYSA-N |
| SMILES | CC1CC(=CC2=CC=C(C=C2)N=[N+]=[N-])C(=O)C(=CC3=CC=C(C=C3)N=[N+]=[N-])C1 |
Computed by PubChem (NCBI)