Products 528525-37-3
CAS 528525-37-3 is the registry number for 5-HT2A receptor agonist-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-1-(2,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 528525-37-3) is a chemical compound with the molecular formula C20H21ClN2O3 and a molecular weight of 372.8 g/mol. IUPAC name: 6-chloro-1-(2,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: RJHMAXLLXKUOBW-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O3 |
|---|---|
| Molecular weight | 372.8 g/mol |
| IUPAC name | 6-chloro-1-(2,4,5-trimethoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | RJHMAXLLXKUOBW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2C3=C(CCN2)C4=C(N3)C=CC(=C4)Cl)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
5-HT2A receptor agonist-2, orb1688528