Products 529-80-6
CAS 529-80-6 appears in our catalog under these names: Multiflorine, Multiflorine, ISO 17034 RM. Offered by: Biosynth, HPC Standards, Sigma-Aldrich. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-4-one (CAS 529-80-6) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. IUPAC name: (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-4-one. InChIKey: HQSKZPOVBDNEGN-NZBPQXDJSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 246.35 g/mol |
| IUPAC name | (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-4-one |
| InChIKey | HQSKZPOVBDNEGN-NZBPQXDJSA-N |
| SMILES | C1CCN2C[C@@H]3C[C@H]([C@@H]2C1)CN4[C@@H]3CC(=O)C=C4 |
Computed by PubChem (NCBI)