CAS 5290-02-8 is the registry number for Heptamethylcyclotetrasiloxan-2-ol. Offered by: TRC. Available pack sizes: 25mg.
2-hydroxy-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 5290-02-8) is a chemical compound with the molecular formula C7H22O5Si4 and a molecular weight of 298.59 g/mol. IUPAC name: 2-hydroxy-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: MLGUQSFCJNMKPT-UHFFFAOYSA-N.
| Molecular formula | C7H22O5Si4 |
|---|---|
| Molecular weight | 298.59 g/mol |
| IUPAC name | 2-hydroxy-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | MLGUQSFCJNMKPT-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)O)(C)C)C |
Computed by PubChem (NCBI)