Products 52919-94-5
CAS 52919-94-5 is the registry number for (E)-(4-Methoxy-4-oxobut-2-en-1-yl)dimethylsulfonium bromide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-4-methoxy-4-oxobut-2-enyl]-dimethylsulfanium bromide (CAS 52919-94-5) is a chemical compound with the molecular formula C7H13BrO2S and a molecular weight of 241.15 g/mol. IUPAC name: [(E)-4-methoxy-4-oxobut-2-enyl]-dimethylsulfanium bromide. InChIKey: OTPHIEOKHHYSIG-FXRZFVDSSA-M.
| Molecular formula | C7H13BrO2S |
|---|---|
| Molecular weight | 241.15 g/mol |
| IUPAC name | [(E)-4-methoxy-4-oxobut-2-enyl]-dimethylsulfanium bromide |
| InChIKey | OTPHIEOKHHYSIG-FXRZFVDSSA-M |
| SMILES | COC(=O)/C=C/C[S+](C)C.[Br-] |
Computed by PubChem (NCBI)