Products 52921-40-1

CAS 52921-40-1 is the registry number for Adenosine Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methyl acetate (CAS 52921-40-1) is a chemical compound with the molecular formula C16H20N6O7 and a molecular weight of 408.37 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: SYQRSDUMMOZBJO-SDBHATRESA-N.

Identity
Molecular formulaC16H20N6O7
Molecular weight408.37 g/mol
IUPAC name[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methyl acetate
InChIKeySYQRSDUMMOZBJO-SDBHATRESA-N
SMILESCC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=C(N=C32)N)N)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)