Products 529475-31-8
CAS 529475-31-8 is the registry number for L-DOPA Ethyl Ester Citrate. Offered by: TRC. Available pack sizes: 500mg.
Ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 529475-31-8) is a chemical compound with the molecular formula C17H23NO11 and a molecular weight of 417.4 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: OMANKJPDQJNEDL-QRPNPIFTSA-N.
| Molecular formula | C17H23NO11 |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | OMANKJPDQJNEDL-QRPNPIFTSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC(=C(C=C1)O)O)N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
L-DOPA Ethyl Ester Citrate