CAS 529500-72-9 appears in our catalog under these names: RORγ inverse agonist 1/ 97.31% (existing batch purity), 2-((4-Methyl-N-(3-(trifluoromethyl)phenyl)phenyl)sulfonamido)-N-(pyridin-4-ylmethyl)acetamide, 98%, 98%, RORγ inverse agonist 1, 99.46%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 10 mg.
2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-4-ylmethyl)acetamide (CAS 529500-72-9) is a chemical compound with the molecular formula C22H20F3N3O3S and a molecular weight of 463.5 g/mol. IUPAC name: 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-4-ylmethyl)acetamide. InChIKey: BELQBTOQMMQYFF-UHFFFAOYSA-N.
| Molecular formula | C22H20F3N3O3S |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-4-ylmethyl)acetamide |
| InChIKey | BELQBTOQMMQYFF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)NCC2=CC=NC=C2)C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)