CAS 530-79-0 appears in our catalog under these names: Naphthol AS-BI Phosphate Disodium Salt, Naphthol As-Bi-Phosphate disodium, Sodium 6-bromo-3-((2-methoxyphenyl)carbamoyl)naphthalen-2-yl phosphate, 98%, 98%, Naphthol AS-BI phosphate (sodium). Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2,5g, 2g, 250mg, 250 mg, 100 mg, 1 g.
Disodium;[6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] phosphate (CAS 530-79-0) is a chemical compound with the molecular formula C18H13BrNNa2O6P and a molecular weight of 496.2 g/mol. IUPAC name: disodium;[6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] phosphate. InChIKey: HESHHBAVKCAKQF-UHFFFAOYSA-L.
| Molecular formula | C18H13BrNNa2O6P |
|---|---|
| Molecular weight | 496.2 g/mol |
| IUPAC name | disodium;[6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] phosphate |
| InChIKey | HESHHBAVKCAKQF-UHFFFAOYSA-L |
| SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)