Products 53001-06-2

CAS 53001-06-2 is the registry number for 2,2-Diphenyl-4-pentenylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,2-diphenylpent-4-en-1-amine (CAS 53001-06-2) is a chemical compound with the molecular formula C17H19N and a molecular weight of 237.34 g/mol. IUPAC name: 2,2-diphenylpent-4-en-1-amine. InChIKey: HJJWTYHOHXVVSP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19N
Molecular weight237.34 g/mol
IUPAC name2,2-diphenylpent-4-en-1-amine
InChIKeyHJJWTYHOHXVVSP-UHFFFAOYSA-N
SMILESC=CCC(CN)(C1=CC=CC=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)