CAS 53005-05-3 appears in our catalog under these names: 6,6'-(Ethene-1,2-diyl)bis(3-isothiocyanatobenzenesulfonic acid), 98+%, DIDS, Disodium Salt 1PC X 250MG, 4,4'-Diisothiocyanatostilbene-2,2'-disulfonic acid, DIDS. Offered by: Chemat Brand, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: on request, 250MG, Get quote.
5-isothiocyanato-2-[2-(4-isothiocyanato-2-sulfophenyl)ethenyl]benzenesulfonic acid (CAS 53005-05-3) is a chemical compound with the molecular formula C16H10N2O6S4 and a molecular weight of 454.5 g/mol. IUPAC name: 5-isothiocyanato-2-[2-(4-isothiocyanato-2-sulfophenyl)ethenyl]benzenesulfonic acid. InChIKey: YSCNMFDFYJUPEF-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O6S4 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 5-isothiocyanato-2-[2-(4-isothiocyanato-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| InChIKey | YSCNMFDFYJUPEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=S)S(=O)(=O)O)C=CC2=C(C=C(C=C2)N=C=S)S(=O)(=O)O |
Computed by PubChem (NCBI)