CAS 53007-37-7 appears in our catalog under these names: Sodium 2-methylmalonate 98%, Sodium 2-methylmalonate, 97%, 97%, Propanedioic acid, 2-methyl-, sodium salt (1:2), 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
Disodium;2-methylpropanedioate (CAS 53007-37-7) is a chemical compound with the molecular formula C4H4Na2O4 and a molecular weight of 162.05 g/mol. IUPAC name: disodium;2-methylpropanedioate. InChIKey: JMSOEMHXPLCJRC-UHFFFAOYSA-L.
| Molecular formula | C4H4Na2O4 |
|---|---|
| Molecular weight | 162.05 g/mol |
| IUPAC name | disodium;2-methylpropanedioate |
| InChIKey | JMSOEMHXPLCJRC-UHFFFAOYSA-L |
| SMILES | CC(C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)