CAS 53046-98-3 appears in our catalog under these names: Z-Gly-Gly-Leu-pNA, Z–Gly–Gly–Leu–pNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg, 100mg, 2000mg, 25mg.
Benzyl N-[2-[[2-[[(2S)-4-methyl-2-(4-nitroanilino)pentanoyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (CAS 53046-98-3) is a chemical compound with the molecular formula C24H29N5O7 and a molecular weight of 499.5 g/mol. IUPAC name: benzyl N-[2-[[2-[[(2S)-4-methyl-2-(4-nitroanilino)pentanoyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate. InChIKey: HFYACNWCMITZBZ-FQEVSTJZSA-N.
| Molecular formula | C24H29N5O7 |
|---|---|
| Molecular weight | 499.5 g/mol |
| IUPAC name | benzyl N-[2-[[2-[[(2S)-4-methyl-2-(4-nitroanilino)pentanoyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| InChIKey | HFYACNWCMITZBZ-FQEVSTJZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC(=O)CNC(=O)CNC(=O)OCC1=CC=CC=C1)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)