CAS 53053-08-0 appears in our catalog under these names: N-Hydroxysuccinimidyl-4-azidobenzoate, 97%, N3-Ph-NHS ester, N3–Ph–NHS ester, N-Hydroxysuccinimide 4-Azidobenzoate, >95.0%(HPLC), N3-Ph-NHS ester 99%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25mg, 50mg, 100mg, 50 mg, 25 mg.
(2,5-dioxopyrrolidin-1-yl) 4-azidobenzoate (CAS 53053-08-0) is a chemical compound with the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-azidobenzoate. InChIKey: LWAVGNJLLQSNNN-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O4 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-azidobenzoate |
| InChIKey | LWAVGNJLLQSNNN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)N=[N+]=[N-] |
Computed by PubChem (NCBI)