CAS 5310-68-9 appears in our catalog under these names: 4-Chlorophenylsulfur pentafluoride, 95%, 4–Chlorophenylsulfur Pentafluoride, 4-Chlorophenylsulfur Pentafluoride 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 200mg, 100mg, 250mg.
(4-chlorophenyl)-pentafluoro-lambda6-sulfane (CAS 5310-68-9) is a chemical compound with the molecular formula C6H4ClF5S and a molecular weight of 238.61 g/mol. IUPAC name: (4-chlorophenyl)-pentafluoro-lambda6-sulfane. InChIKey: AZOPETVFRMSFNY-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF5S |
|---|---|
| Molecular weight | 238.61 g/mol |
| IUPAC name | (4-chlorophenyl)-pentafluoro-lambda6-sulfane |
| InChIKey | AZOPETVFRMSFNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(F)(F)(F)(F)F)Cl |
Computed by PubChem (NCBI)