CAS 53103-82-5 is the registry number for 1-Phenyl-3-(4-chlorostyrene)pyrazole. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.
5-(4-chlorophenyl)-3-[(E)-2-(4-chlorophenyl)ethenyl]-1-phenylpyrazole (CAS 53103-82-5) is a chemical compound with the molecular formula C23H16Cl2N2 and a molecular weight of 391.3 g/mol. IUPAC name: 5-(4-chlorophenyl)-3-[(E)-2-(4-chlorophenyl)ethenyl]-1-phenylpyrazole. InChIKey: FGPBMSAKTIJTOE-OVCLIPMQSA-N.
| Molecular formula | C23H16Cl2N2 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3-[(E)-2-(4-chlorophenyl)ethenyl]-1-phenylpyrazole |
| InChIKey | FGPBMSAKTIJTOE-OVCLIPMQSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)/C=C/C3=CC=C(C=C3)Cl)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)