CAS 53109-82-3 is the registry number for Bis(L-ornithinato-N2,O)-copper. Offered by: TRC. Available pack sizes: 250mg.
Copper bis(2,5-diaminopentanoate) (CAS 53109-82-3) is a chemical compound with the molecular formula C10H22CuN4O4 and a molecular weight of 325.85 g/mol. IUPAC name: copper bis(2,5-diaminopentanoate). InChIKey: CRJSDECKGYKROL-UHFFFAOYSA-L.
| Molecular formula | C10H22CuN4O4 |
|---|---|
| Molecular weight | 325.85 g/mol |
| IUPAC name | copper bis(2,5-diaminopentanoate) |
| InChIKey | CRJSDECKGYKROL-UHFFFAOYSA-L |
| SMILES | C(CC(C(=O)[O-])N)CN.C(CC(C(=O)[O-])N)CN.[Cu+2] |
Computed by PubChem (NCBI)