CAS 531506-36-2 appears in our catalog under these names: A2B receptor antagonist 1/ 98.83% (existing batch purity), A2B receptor antagonist 1, A2B receptor antagonist 1. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 1 mg.
8-(1-benzylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione (CAS 531506-36-2) is a chemical compound with the molecular formula C21H24N6O2 and a molecular weight of 392.5 g/mol. IUPAC name: 8-(1-benzylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione. InChIKey: IWZAITCKZZQXCV-UHFFFAOYSA-N.
| Molecular formula | C21H24N6O2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 8-(1-benzylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| InChIKey | IWZAITCKZZQXCV-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3=CN(N=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)