CAS 53177-12-1 appears in our catalog under these names: [N,N 0-Disalicylidene-1,2-ethanediaminato-(2-)]manganese(iii) chloride, 95%, (N,N 0-Disalicylidene-1,2-ethanediaminato-(2-))manganese(III) Chloride, Manganese(salen) chloride, Manganese(salen) chloride/ 99.14% (existing batch purity), EUK-8 95%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg.
Manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride (CAS 53177-12-1) is a chemical compound with the molecular formula C16H14ClMnN2O2 and a molecular weight of 356.68 g/mol. IUPAC name: manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride. InChIKey: HBQGFROGWOHBAG-UHFFFAOYSA-K.
| Molecular formula | C16H14ClMnN2O2 |
|---|---|
| Molecular weight | 356.68 g/mol |
| IUPAC name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride |
| InChIKey | HBQGFROGWOHBAG-UHFFFAOYSA-K |
| SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2[O-])[O-].[Cl-].[Mn+3] |
Computed by PubChem (NCBI)