Products 5321-65-3

CAS 5321-65-3 is the registry number for Meclizine Impurity 1 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,4-bis[(3-methylphenyl)methyl]piperazine;dihydrochloride (CAS 5321-65-3) is a chemical compound with the molecular formula C20H28Cl2N2 and a molecular weight of 367.4 g/mol. IUPAC name: 1,4-bis[(3-methylphenyl)methyl]piperazine;dihydrochloride. InChIKey: RBZJAYKYBXBPIN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H28Cl2N2
Molecular weight367.4 g/mol
IUPAC name1,4-bis[(3-methylphenyl)methyl]piperazine;dihydrochloride
InChIKeyRBZJAYKYBXBPIN-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)CN2CCN(CC2)CC3=CC=CC(=C3)C.Cl.Cl

Computed by PubChem (NCBI)