Products 53225-58-4
CAS 53225-58-4 is the registry number for 5-O-Trityl-D-ribose. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2g.
(3R,4S,5R)-5-(trityloxymethyl)oxolane-2,3,4-triol (CAS 53225-58-4) is a chemical compound with the molecular formula C24H24O5 and a molecular weight of 392.4 g/mol. IUPAC name: (3R,4S,5R)-5-(trityloxymethyl)oxolane-2,3,4-triol. InChIKey: ZAZZFZLLPGMINF-YRNFEDNZSA-N.
| Molecular formula | C24H24O5 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | (3R,4S,5R)-5-(trityloxymethyl)oxolane-2,3,4-triol |
| InChIKey | ZAZZFZLLPGMINF-YRNFEDNZSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC[C@@H]4[C@H]([C@H](C(O4)O)O)O |
Computed by PubChem (NCBI)