CAS 5325-88-2 appears in our catalog under these names: 1,5-Dimercaptonaphthalene, 95%, 1,5–Dimercaptonaphthalene, 1,5-Dimercaptonaphthalene, >98.0%(GC)(T), 1,5-Dimercaptonaphthalene 98%, 1,5-Dimercaptonaphthalene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
Naphthalene-1,5-dithiol (CAS 5325-88-2) is a chemical compound with the molecular formula C10H8S2 and a molecular weight of 192.3 g/mol. IUPAC name: naphthalene-1,5-dithiol. InChIKey: AAPAGLBSROJFGM-UHFFFAOYSA-N.
| Molecular formula | C10H8S2 |
|---|---|
| Molecular weight | 192.3 g/mol |
| IUPAC name | naphthalene-1,5-dithiol |
| InChIKey | AAPAGLBSROJFGM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2S)C(=C1)S |
Computed by PubChem (NCBI)