Products 53254-75-4
CAS 53254-75-4 is the registry number for (3R,5S)-[4]-Gingerdiol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,5S)-1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol (CAS 53254-75-4) is a chemical compound with the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. IUPAC name: (3R,5S)-1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol. InChIKey: SVZGCYLXISBVQK-QWHCGFSZSA-N.
| Molecular formula | C15H24O4 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | (3R,5S)-1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol |
| InChIKey | SVZGCYLXISBVQK-QWHCGFSZSA-N |
| SMILES | CCC[C@@H](C[C@@H](CCC1=CC(=C(C=C1)O)OC)O)O |
Computed by PubChem (NCBI)