CAS 53254-99-2 is the registry number for 5-(2,4,6-trihydroxyphenoxy)benzene-1,2,3-triol. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4,5-trihydroxyphenoxy)benzene-1,3,5-triol (CAS 53254-99-2) is a chemical compound with the molecular formula C12H10O7 and a molecular weight of 266.20 g/mol. IUPAC name: 2-(3,4,5-trihydroxyphenoxy)benzene-1,3,5-triol. InChIKey: PYUFXOMNRPZYTI-UHFFFAOYSA-N.
| Molecular formula | C12H10O7 |
|---|---|
| Molecular weight | 266.20 g/mol |
| IUPAC name | 2-(3,4,5-trihydroxyphenoxy)benzene-1,3,5-triol |
| InChIKey | PYUFXOMNRPZYTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)OC2=CC(=C(C(=C2)O)O)O)O)O |
Computed by PubChem (NCBI)