CAS 53262-00-3 appears in our catalog under these names: Z-Leu-trp-oh, 95%, Z–Leu–Trp–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 5g.
(2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propanoic acid (CAS 53262-00-3) is a chemical compound with the molecular formula C25H29N3O5 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propanoic acid. InChIKey: OCRUSZPWPXFIFZ-VXKWHMMOSA-N.
| Molecular formula | C25H29N3O5 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propanoic acid |
| InChIKey | OCRUSZPWPXFIFZ-VXKWHMMOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)