CAS 533-20-0 is the registry number for 1-(2,4-Dimethylbenzyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,4-dimethylphenyl)methyl]guanidine (CAS 533-20-0) is a chemical compound with the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. IUPAC name: 2-[(2,4-dimethylphenyl)methyl]guanidine. InChIKey: CHGFKTPQFXYCAN-UHFFFAOYSA-N.
| Molecular formula | C10H15N3 |
|---|---|
| Molecular weight | 177.25 g/mol |
| IUPAC name | 2-[(2,4-dimethylphenyl)methyl]guanidine |
| InChIKey | CHGFKTPQFXYCAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CN=C(N)N)C |
Computed by PubChem (NCBI)