CAS 5331-87-3 appears in our catalog under these names: 3,3'-Dichlorodiphenyl 4,4'-diisocyanate, 95%, 3,3'-Dichloro-4,4'-diisocyanato-1,1'-biphenyl, 95%, 3,3'–Dichloro–4,4'–diisocyanatobiphenyl, 3,3'-Dichlorodiphenyl 4,4'-diisocyanate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 10g, 5g, 25g.
2-chloro-4-(3-chloro-4-isocyanatophenyl)-1-isocyanatobenzene (CAS 5331-87-3) is a chemical compound with the molecular formula C14H6Cl2N2O2 and a molecular weight of 305.1 g/mol. IUPAC name: 2-chloro-4-(3-chloro-4-isocyanatophenyl)-1-isocyanatobenzene. InChIKey: JITXMLLVGWGFGV-UHFFFAOYSA-N.
| Molecular formula | C14H6Cl2N2O2 |
|---|---|
| Molecular weight | 305.1 g/mol |
| IUPAC name | 2-chloro-4-(3-chloro-4-isocyanatophenyl)-1-isocyanatobenzene |
| InChIKey | JITXMLLVGWGFGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N=C=O)Cl)Cl)N=C=O |
Computed by PubChem (NCBI)