CAS 53365-89-2 is the registry number for Ethyl 5-carboxy-4-ethyl-3-methyl-2-pyrrolecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-ethoxycarbonyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate (CAS 53365-89-2) is a chemical compound with the molecular formula C11H14NO4- and a molecular weight of 224.23 g/mol. IUPAC name: 5-ethoxycarbonyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate. InChIKey: MKNHWTOENPMOPQ-UHFFFAOYSA-M.
| Molecular formula | C11H14NO4- |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 5-ethoxycarbonyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate |
| InChIKey | MKNHWTOENPMOPQ-UHFFFAOYSA-M |
| SMILES | CCC1=C(NC(=C1C)C(=O)OCC)C(=O)[O-] |
Computed by PubChem (NCBI)