Products 533903-25-2

CAS 533903-25-2 is the registry number for N1-Cbz-N2-Boc-N1-[2-(Boc-amino)ethyl]-1,2-ethanediamine, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Benzyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate (CAS 533903-25-2) is a chemical compound with the molecular formula C22H35N3O6 and a molecular weight of 437.5 g/mol. IUPAC name: benzyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate. InChIKey: WQQQOGWMNZZDKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H35N3O6
Molecular weight437.5 g/mol
IUPAC namebenzyl N,N-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate
InChIKeyWQQQOGWMNZZDKZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCN(CCNC(=O)OC(C)(C)C)C(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)