CAS 53391-78-9 is the registry number for 2-Chloro-3-hydroxy-7,8,9,10-tetrahydro-6h-benzo[c]chromen-6-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (CAS 53391-78-9) is a chemical compound with the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. IUPAC name: 2-chloro-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one. InChIKey: PIZFKAWPTPSHFH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 2-chloro-3-hydroxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| InChIKey | PIZFKAWPTPSHFH-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=CC(=C(C=C3OC2=O)O)Cl |
Computed by PubChem (NCBI)