CAS 53404-32-3 is the registry number for Dichlorprop Dimethylammonium Salt. Offered by: TRC. Available pack sizes: 1g.
2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine (CAS 53404-32-3) is a chemical compound with the molecular formula C11H15Cl2NO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine. InChIKey: WRXSEWUFHVTFEX-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine |
| InChIKey | WRXSEWUFHVTFEX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl.CNC |
Computed by PubChem (NCBI)