Products 53404-32-3

CAS 53404-32-3 is the registry number for Dichlorprop Dimethylammonium Salt. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine (CAS 53404-32-3) is a chemical compound with the molecular formula C11H15Cl2NO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine. InChIKey: WRXSEWUFHVTFEX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Cl2NO3
Molecular weight280.14 g/mol
IUPAC name2-(2,4-dichlorophenoxy)propanoic acid;N-methylmethanamine
InChIKeyWRXSEWUFHVTFEX-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl.CNC

Computed by PubChem (NCBI)