Products 53411-64-6
CAS 53411-64-6 is the registry number for L-Lysine (sulfite). Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis((2S)-2,6-diaminohexanoic acid);sulfurous acid (CAS 53411-64-6) is a chemical compound with the molecular formula C12H30N4O7S and a molecular weight of 374.46 g/mol. IUPAC name: bis((2S)-2,6-diaminohexanoic acid);sulfurous acid. InChIKey: KZLGXGJMZNZGJJ-MDTVQASCSA-N.
| Molecular formula | C12H30N4O7S |
|---|---|
| Molecular weight | 374.46 g/mol |
| IUPAC name | bis((2S)-2,6-diaminohexanoic acid);sulfurous acid |
| InChIKey | KZLGXGJMZNZGJJ-MDTVQASCSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)N.C(CCN)C[C@@H](C(=O)O)N.OS(=O)O |
Computed by PubChem (NCBI)