Products 53473-36-2
CAS 53473-36-2 appears in our catalog under these names: 4-(Trifluoromethyl)hydrocinnamic Acid, 3–(4–(Trifluoromethyl)phenyl)propionic Acid, 3-[4-(Trifluoromethyl)phenyl]propionic Acid, >98.0%(T), 4-(Trifluoromethyl)hydrocinnamic acid, 95%, 4-(Trifluoromethyl)hydrocinnamic acid 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g, 50g.
3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 53473-36-2) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: OEIUMLSCWINLBB-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | OEIUMLSCWINLBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
3-[4-(Trifluoromethyl)phenyl]propionic acid, 3-(4-(trifluoromethyl)phenyl)propionic acid, 4-(Trifluoromethyl)hydrocinnamic acid, 3-[4-(trifluoromethyl)phenyl]propanoic Acid, 3-(4-(trifluoromethyl)phenyl)propanoic acid, Cinacalcet Impurity 53, 3-(4-Trifluromethylphenyl)propanoic acid, 3-(4-Trifluoromethylphenyl)propionic acid, 4-trifluoromethylhydrocinnamic acid, 4-(trifluoromethyl)-hydrocinnamic acid