CAS 5348-48-1 is the registry number for Divicine Sulfate, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Bis(2,4-diamino-5-hydroxy-1H-pyrimidin-6-one);sulfuric acid (CAS 5348-48-1) is a chemical compound with the molecular formula C8H14N8O8S and a molecular weight of 382.31 g/mol. IUPAC name: bis(2,4-diamino-5-hydroxy-1H-pyrimidin-6-one);sulfuric acid. InChIKey: CKNOXJJKFIPPBD-UHFFFAOYSA-N.
| Molecular formula | C8H14N8O8S |
|---|---|
| Molecular weight | 382.31 g/mol |
| IUPAC name | bis(2,4-diamino-5-hydroxy-1H-pyrimidin-6-one);sulfuric acid |
| InChIKey | CKNOXJJKFIPPBD-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)N)O.C1(=C(N=C(NC1=O)N)N)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)