CAS 53490-78-1 is the registry number for Desbromo Leptophos. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-lambda5-phosphane (CAS 53490-78-1) is a chemical compound with the molecular formula C13H11Cl2O2PS and a molecular weight of 333.2 g/mol. IUPAC name: (2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-lambda5-phosphane. InChIKey: HBGSTGQUUANUBS-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2O2PS |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | (2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-lambda5-phosphane |
| InChIKey | HBGSTGQUUANUBS-UHFFFAOYSA-N |
| SMILES | COP(=S)(C1=CC=CC=C1)OC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)