CAS 53494-70-5 appears in our catalog under these names: δ-Ketoendrin, >95% (GC), Endrin-ketone, Endrin-ketone 10 µg/mL in Cyclohexane, Endrin-ketone 100 µg/mL in Cyclohexane, Endrin–ketone. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress, Roth. Available pack sizes: 100mg, 1g, 10mg, 10ml, 1ml, 10 mg, 25 mg, 5 mg.
1,2,2,3,10,11-hexachloropentacyclo[5.4.1.03,10.04,12.05,9]dodecan-8-one (CAS 53494-70-5) is a chemical compound with the molecular formula C12H8Cl6O and a molecular weight of 380.9 g/mol. IUPAC name: 1,2,2,3,10,11-hexachloropentacyclo[5.4.1.03,10.04,12.05,9]dodecan-8-one. InChIKey: IZHZFAQWVKBTSL-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl6O |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 1,2,2,3,10,11-hexachloropentacyclo[5.4.1.03,10.04,12.05,9]dodecan-8-one |
| InChIKey | IZHZFAQWVKBTSL-UHFFFAOYSA-N |
| SMILES | C1C2C3C4C1C(=O)C2C5(C3(C(C4(C5Cl)Cl)(Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)