CAS 5350-75-4 is the registry number for N-Benzyl-N,N-dipropylpropan-1-aminium bromide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 25g.
Benzyl(tripropyl)azanium bromide (CAS 5350-75-4) is a chemical compound with the molecular formula C16H28BrN and a molecular weight of 314.30 g/mol. IUPAC name: benzyl(tripropyl)azanium bromide. InChIKey: OSPKGDDLQQVQSG-UHFFFAOYSA-M.
| Molecular formula | C16H28BrN |
|---|---|
| Molecular weight | 314.30 g/mol |
| IUPAC name | benzyl(tripropyl)azanium bromide |
| InChIKey | OSPKGDDLQQVQSG-UHFFFAOYSA-M |
| SMILES | CCC[N+](CCC)(CCC)CC1=CC=CC=C1.[Br-] |
Computed by PubChem (NCBI)