CAS 53500-38-2 is the registry number for 2,4-Dibromo-6-((tert-butylamino)methyl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,4-dibromo-6-[(tert-butylamino)methyl]phenol (CAS 53500-38-2) is a chemical compound with the molecular formula C11H15Br2NO and a molecular weight of 337.05 g/mol. IUPAC name: 2,4-dibromo-6-[(tert-butylamino)methyl]phenol. InChIKey: POVQXWGLNGROCY-UHFFFAOYSA-N.
| Molecular formula | C11H15Br2NO |
|---|---|
| Molecular weight | 337.05 g/mol |
| IUPAC name | 2,4-dibromo-6-[(tert-butylamino)methyl]phenol |
| InChIKey | POVQXWGLNGROCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=C(C(=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)