CAS 53510-88-6 appears in our catalog under these names: Phthalimide-15N Potassium Salt, Potassium 1,3–dioxoisoindolin–2–ide–15N, PHTHALIMIDE-15N POTASSIUM SALT, 98 ATOM&. Offered by: TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 5G.
Potassium isoindol-2-ide-1,3-dione (CAS 53510-88-6) is a chemical compound with the molecular formula C8H4KNO2 and a molecular weight of 186.21 g/mol. IUPAC name: potassium isoindol-2-ide-1,3-dione. InChIKey: FYRHIOVKTDQVFC-DLBIPZKSSA-M.
| Molecular formula | C8H4KNO2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | potassium isoindol-2-ide-1,3-dione |
| InChIKey | FYRHIOVKTDQVFC-DLBIPZKSSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)[15N-]C2=O.[K+] |
Computed by PubChem (NCBI)