CAS 5354-81-4 is the registry number for Indomethacin Impurity 15 Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium N-(4-methoxyphenyl)iminosulfamate (CAS 5354-81-4) is a chemical compound with the molecular formula C7H7N2NaO4S and a molecular weight of 238.20 g/mol. IUPAC name: sodium N-(4-methoxyphenyl)iminosulfamate. InChIKey: KGVCKOLMXFFRDV-UHFFFAOYSA-M.
| Molecular formula | C7H7N2NaO4S |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | sodium N-(4-methoxyphenyl)iminosulfamate |
| InChIKey | KGVCKOLMXFFRDV-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)N=NS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)