CAS 53551-74-9 is the registry number for 2-Mercapto-4,6-di-tert-butylphenol. Offered by: Biosynth. Available pack sizes: 100mg, 250mg.
2,4-ditert-butyl-6-sulfanylphenol (CAS 53551-74-9) is a chemical compound with the molecular formula C14H22OS and a molecular weight of 238.39 g/mol. IUPAC name: 2,4-ditert-butyl-6-sulfanylphenol. InChIKey: SEUXZGMOSAXITB-UHFFFAOYSA-N.
| Molecular formula | C14H22OS |
|---|---|
| Molecular weight | 238.39 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-sulfanylphenol |
| InChIKey | SEUXZGMOSAXITB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)S)O)C(C)(C)C |
Computed by PubChem (NCBI)