CAS 53555-63-8 is the registry number for 1,2,3,5-Tetrachloronaphthalene. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,5-tetrachloronaphthalene (CAS 53555-63-8) is a chemical compound with the molecular formula C10H4Cl4 and a molecular weight of 265.9 g/mol. IUPAC name: 1,2,3,5-tetrachloronaphthalene. InChIKey: HJJKSUVYCQAMBG-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl4 |
|---|---|
| Molecular weight | 265.9 g/mol |
| IUPAC name | 1,2,3,5-tetrachloronaphthalene |
| InChIKey | HJJKSUVYCQAMBG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2C(=C1)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)