CAS 5356-99-0 is the registry number for [[(Chloromethyl)dimethylsilyl]methyl]benzene, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg.
Benzyl-(chloromethyl)-dimethylsilane (CAS 5356-99-0) is a chemical compound with the molecular formula C10H15ClSi and a molecular weight of 198.76 g/mol. IUPAC name: benzyl-(chloromethyl)-dimethylsilane. InChIKey: MEMDIECPWPQFCX-UHFFFAOYSA-N.
| Molecular formula | C10H15ClSi |
|---|---|
| Molecular weight | 198.76 g/mol |
| IUPAC name | benzyl-(chloromethyl)-dimethylsilane |
| InChIKey | MEMDIECPWPQFCX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CC1=CC=CC=C1)CCl |
Computed by PubChem (NCBI)