CAS 53598-01-9 appears in our catalog under these names: Nω-Hydroxy-L-arginine monoacetate, NG–Hydroxy–L–arginine acetate salt, NG-Hydroxy-L-arginine, Monoa 1PC X 5MG, L-hydroxy Arginine (acetate), NG-Hydroxy-L-arginine (acetate). Offered by: Chemat Brand, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5MG, 10 mg, 5 mg.
Acetic acid;(2S)-2-amino-5-[[amino-(hydroxyamino)methylidene]amino]pentanoic acid (CAS 53598-01-9) is a chemical compound with the molecular formula C8H18N4O5 and a molecular weight of 250.25 g/mol. IUPAC name: acetic acid;(2S)-2-amino-5-[[amino-(hydroxyamino)methylidene]amino]pentanoic acid. InChIKey: VYMCYRPQICLHKC-WCCKRBBISA-N.
| Molecular formula | C8H18N4O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | acetic acid;(2S)-2-amino-5-[[amino-(hydroxyamino)methylidene]amino]pentanoic acid |
| InChIKey | VYMCYRPQICLHKC-WCCKRBBISA-N |
| SMILES | CC(=O)O.C(C[C@@H](C(=O)O)N)CN=C(N)NO |
Computed by PubChem (NCBI)