CAS 53599-40-9 appears in our catalog under these names: Furfural-3,4,5-d3, >95% (GC), Furfural-3,4,5-d3 (stabilized with BHT), >95% (GC), Furfural-3,4,5-d3, 98 atom % D, min 96% Chemical Purity, FURFURAL–3,4,5–D3, D3-Furfural. Offered by: TRC, CDN, GLPBio, HPC Standards. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 1x10mg.
3,4,5-trideuteriofuran-2-carbaldehyde (CAS 53599-40-9) is a chemical compound with the molecular formula C5H4O2 and a molecular weight of 99.10 g/mol. IUPAC name: 3,4,5-trideuteriofuran-2-carbaldehyde. InChIKey: HYBBIBNJHNGZAN-CBYSEHNBSA-N.
| Molecular formula | C5H4O2 |
|---|---|
| Molecular weight | 99.10 g/mol |
| IUPAC name | 3,4,5-trideuteriofuran-2-carbaldehyde |
| InChIKey | HYBBIBNJHNGZAN-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(OC(=C1[2H])C=O)[2H] |
Computed by PubChem (NCBI)