CAS 53607-81-1 appears in our catalog under these names: Phenyramidol Glucuronide (Mixture of Diastereomers), Phenyramidol Glucuronide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[1-phenyl-2-(pyridin-2-ylamino)ethoxy]oxane-2-carboxylic acid (CAS 53607-81-1) is a chemical compound with the molecular formula C19H22N2O7 and a molecular weight of 390.4 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[1-phenyl-2-(pyridin-2-ylamino)ethoxy]oxane-2-carboxylic acid. InChIKey: MCRHUVXLYYFQQH-LMQNMRCQSA-N.
| Molecular formula | C19H22N2O7 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[1-phenyl-2-(pyridin-2-ylamino)ethoxy]oxane-2-carboxylic acid |
| InChIKey | MCRHUVXLYYFQQH-LMQNMRCQSA-N |
| SMILES | C1=CC=C(C=C1)C(CNC2=CC=CC=N2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)